C12H17NO7 — CID 171379695
6-[3-(carboxymethyl)-3-hydroxy-2,5-dioxopyrrolidin-1-yl]hexanoic acid (PubChem CID 171379695) has the molecular formula C12H17NO7 and a molecular weight of 287.27 g/mol. Its IUPAC name is 6-[3-(carboxymethyl)-3-hydroxy-2,5-dioxopyrrolidin-1-yl]hexanoic acid.
| Compound Name | 6-[3-(carboxymethyl)-3-hydroxy-2,5-dioxopyrrolidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 171379695 |
| Molecular Formula | C12H17NO7 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 6-[3-(carboxymethyl)-3-hydroxy-2,5-dioxopyrrolidin-1-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)CC(O)(CC(=O)O)C1=O |
| InChI | InChI=1S/C12H17NO7/c14-8-6-12(20,7-10(17)18)11(19)13(8)5-3-1-2-4-9(15)16/h20H,1-7H2,(H,15,16)(H,17,18) |
| InChIKey | VRJLAIMFXZYWQH-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|