6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid

C12H17NO5 — CID 102689235

IUPAC6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid
SMILESO=C(O)CCCCCN1C(=O)C2CCC(O2)C1=O
InChIInChI=1S/C12H17NO5/c14-10(15)4-2-1-3-7-13-11(16)8-5-6-9(18-8)12(13)17/h8-9H,1-7H2,(H,14,15)
InChIKeyHALOKCYPGNWZCY-UHFFFAOYSA-N
MW255.27 g/mol
LogP0.55
Rot. Bonds6

About 6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid

6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid (PubChem CID 102689235) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid.

Molecular Properties

Compound Name6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid
PubChem CID102689235
Molecular FormulaC12H17NO5
Molecular Weight255.27 g/mol
Exact Mass255.11
IUPAC Name6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid
SMILESO=C(O)CCCCCN1C(=O)C2CCC(O2)C1=O
InChIInChI=1S/C12H17NO5/c14-10(15)4-2-1-3-7-13-11(16)8-5-6-9(18-8)12(13)17/h8-9H,1-7H2,(H,14,15)
InChIKeyHALOKCYPGNWZCY-UHFFFAOYSA-N
XLogP0.55
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.27
LogP ≤ 50.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid?
The IUPAC name of 6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid (CID 102689235) is 6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid.
What is the SMILES notation for 6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid?
The canonical SMILES for 6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid is O=C(O)CCCCCN1C(=O)C2CCC(O2)C1=O.
What is the InChIKey of 6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid?
The InChIKey is HALOKCYPGNWZCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO5/c14-10(15)4-2-1-3-7-13-11(16)8-5-6-9(18-8)12(13)17/h8-9H,1-7H2,(H,14,15).
What are the key properties of 6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid?
6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid has a molecular weight of 255.27 g/mol, XLogP of 0.55, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-dioxo-8-oxa-3-azabicyclo[3.2.1]octan-3-yl)hexanoic acid is sourced from PubChem (CID 102689235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).