C11H20N2O2S — CID 87234060
1-butyl-3-ethyl-5-methyl-5-(sulfanylmethyl)imidazolidine-2,4-dione (PubChem CID 87234060) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 1-butyl-3-ethyl-5-methyl-5-(sulfanylmethyl)imidazolidine-2,4-dione.
| Compound Name | 1-butyl-3-ethyl-5-methyl-5-(sulfanylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 87234060 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1-butyl-3-ethyl-5-methyl-5-(sulfanylmethyl)imidazolidine-2,4-dione |
| SMILES | CCCCN1C(=O)N(CC)C(=O)C1(C)CS |
| InChI | InChI=1S/C11H20N2O2S/c1-4-6-7-13-10(15)12(5-2)9(14)11(13,3)8-16/h16H,4-8H2,1-3H3 |
| InChIKey | SUNCFXFMYQRKSA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|