C15H22O — CID 101020022
(1aR,4R,4aR,5S,8aS)-4,4a-dimethyl-5-prop-1-en-2-yl-1a,2,3,4,5,8-hexahydronaphtho[1,8a-b]oxirene (PubChem CID 101020022) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (1aR,4R,4aR,5S,8aS)-4,4a-dimethyl-5-prop-1-en-2-yl-1a,2,3,4,5,8-hexahydronaphtho[1,8a-b]oxirene.
| Compound Name | (1aR,4R,4aR,5S,8aS)-4,4a-dimethyl-5-prop-1-en-2-yl-1a,2,3,4,5,8-hexahydronaphtho[1,8a-b]oxirene |
|---|---|
| PubChem CID | 101020022 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (1aR,4R,4aR,5S,8aS)-4,4a-dimethyl-5-prop-1-en-2-yl-1a,2,3,4,5,8-hexahydronaphtho[1,8a-b]oxirene |
| SMILES | C=C(C)[C@@H]1C=CC[C@@]23O[C@@H]2CC[C@@H](C)[C@]13C |
| InChI | InChI=1S/C15H22O/c1-10(2)12-6-5-9-15-13(16-15)8-7-11(3)14(12,15)4/h5-6,11-13H,1,7-9H2,2-4H3/t11-,12+,13-,14-,15-/m1/s1 |
| InChIKey | WOYPMLLJPMHZHB-XLWJZTARSA-N |
| XLogP | 3.71 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|