C20H29NO5S3 — CID 101021658
(3aR,4R,7R,7aR)-4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-5-(4-methylphenyl)sulfonyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol (PubChem CID 101021658) has the molecular formula C20H29NO5S3 and a molecular weight of 459.66 g/mol. Its IUPAC name is (3aR,4R,7R,7aR)-4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-5-(4-methylphenyl)sulfonyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol.
| Compound Name | (3aR,4R,7R,7aR)-4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-5-(4-methylphenyl)sulfonyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol |
|---|---|
| PubChem CID | 101021658 |
| Molecular Formula | C20H29NO5S3 |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | (3aR,4R,7R,7aR)-4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-5-(4-methylphenyl)sulfonyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](O)[C@H]3OC(C)(C)O[C@@H]3[C@H]2CC2SCCCS2)cc1 |
| InChI | InChI=1S/C20H29NO5S3/c1-13-5-7-14(8-6-13)29(23,24)21-12-16(22)19-18(25-20(2,3)26-19)15(21)11-17-27-9-4-10-28-17/h5-8,15-19,22H,4,9-12H2,1-3H3/t15-,16-,18-,19-/m1/s1 |
| InChIKey | OYWQEGPAIYEAPT-PSBWJHGTSA-N |
| XLogP | 2.84 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |