C28H66O8Si5 — CID 101025044
trimethyl-[(2R,3R,4S,5R)-6-[3-[methyl-di(propan-2-yloxy)silyl]propoxy]-4,5-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)oxan-3-yl]oxysilane (PubChem CID 101025044) has the molecular formula C28H66O8Si5 and a molecular weight of 671.26 g/mol. Its IUPAC name is trimethyl-[(2R,3R,4S,5R)-6-[3-[methyl-di(propan-2-yloxy)silyl]propoxy]-4,5-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)oxan-3-yl]oxysilane.
| Compound Name | trimethyl-[(2R,3R,4S,5R)-6-[3-[methyl-di(propan-2-yloxy)silyl]propoxy]-4,5-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)oxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 101025044 |
| Molecular Formula | C28H66O8Si5 |
| Molecular Weight | 671.26 g/mol |
| Exact Mass | 670.36 |
| IUPAC Name | trimethyl-[(2R,3R,4S,5R)-6-[3-[methyl-di(propan-2-yloxy)silyl]propoxy]-4,5-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)oxan-3-yl]oxysilane |
| SMILES | CC(C)O[Si](C)(CCCOC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)OC(C)C |
| InChI | InChI=1S/C28H66O8Si5/c1-22(2)32-41(17,33-23(3)4)20-18-19-29-28-27(36-40(14,15)16)26(35-39(11,12)13)25(34-38(8,9)10)24(31-28)21-30-37(5,6)7/h22-28H,18-21H2,1-17H3/t24-,25-,26+,27-,28?/m1/s1 |
| InChIKey | SELDDMFLBNSMGX-GJMNKMQNSA-N |
| XLogP | 7.55 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.26 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|