C22H46O7Si3 — CID 101025047
(3S,3aS,6R,6aS)-2-[3-[methyl-di(propan-2-yloxy)silyl]propyl]-3,6-bis(trimethylsilyloxy)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 101025047) has the molecular formula C22H46O7Si3 and a molecular weight of 506.86 g/mol. Its IUPAC name is (3S,3aS,6R,6aS)-2-[3-[methyl-di(propan-2-yloxy)silyl]propyl]-3,6-bis(trimethylsilyloxy)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (3S,3aS,6R,6aS)-2-[3-[methyl-di(propan-2-yloxy)silyl]propyl]-3,6-bis(trimethylsilyloxy)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 101025047 |
| Molecular Formula | C22H46O7Si3 |
| Molecular Weight | 506.86 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | (3S,3aS,6R,6aS)-2-[3-[methyl-di(propan-2-yloxy)silyl]propyl]-3,6-bis(trimethylsilyloxy)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | CC(C)O[Si](C)(CCCC1O[C@H]2[C@H](OC(=O)[C@@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)OC(C)C |
| InChI | InChI=1S/C22H46O7Si3/c1-15(2)26-32(11,27-16(3)4)14-12-13-17-18(28-30(5,6)7)19-20(24-17)21(22(23)25-19)29-31(8,9)10/h15-21H,12-14H2,1-11H3/t17?,18-,19+,20-,21+/m0/s1 |
| InChIKey | UGFZVTPYERYSAT-KKURMSBHSA-N |
| XLogP | 4.82 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.86 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|