C16H32O2 — CID 101025337
(3S,4S)-4-butyl-2,2,5,5-tetramethyloct-7-ene-3,4-diol (PubChem CID 101025337) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is (3S,4S)-4-butyl-2,2,5,5-tetramethyloct-7-ene-3,4-diol.
| Compound Name | (3S,4S)-4-butyl-2,2,5,5-tetramethyloct-7-ene-3,4-diol |
|---|---|
| PubChem CID | 101025337 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | (3S,4S)-4-butyl-2,2,5,5-tetramethyloct-7-ene-3,4-diol |
| SMILES | C=CCC(C)(C)[C@@](O)(CCCC)[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C16H32O2/c1-8-10-12-16(18,13(17)14(3,4)5)15(6,7)11-9-2/h9,13,17-18H,2,8,10-12H2,1,3-7H3/t13-,16+/m0/s1 |
| InChIKey | DEDCBJIFVRGZCG-XJKSGUPXSA-N |
| XLogP | 3.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|