C11H14ClNO5 — CID 101026257
(3aR,6R,6aS)-5-[5-(chloromethyl)-1,2-oxazol-3-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 101026257) has the molecular formula C11H14ClNO5 and a molecular weight of 275.69 g/mol. Its IUPAC name is (3aR,6R,6aS)-5-[5-(chloromethyl)-1,2-oxazol-3-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,6R,6aS)-5-[5-(chloromethyl)-1,2-oxazol-3-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 101026257 |
| Molecular Formula | C11H14ClNO5 |
| Molecular Weight | 275.69 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | (3aR,6R,6aS)-5-[5-(chloromethyl)-1,2-oxazol-3-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@H]2OC(c3cc(CCl)on3)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C11H14ClNO5/c1-11(2)16-9-7(14)8(15-10(9)17-11)6-3-5(4-12)18-13-6/h3,7-10,14H,4H2,1-2H3/t7-,8?,9+,10-/m1/s1 |
| InChIKey | FOQOCGHBDWTCJO-JOUUOIQHSA-N |
| XLogP | 1.32 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.69 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|