C20H26N4O7 — CID 101027500
dimethyl (1S,2S)-4-methyl-2-[(2-methyl-5-nitroimidazol-1-yl)methyl]-6-morpholin-4-ylcyclohexa-3,5-diene-1,3-dicarboxylate (PubChem CID 101027500) has the molecular formula C20H26N4O7 and a molecular weight of 434.45 g/mol. Its IUPAC name is dimethyl (1S,2S)-4-methyl-2-[(2-methyl-5-nitroimidazol-1-yl)methyl]-6-morpholin-4-ylcyclohexa-3,5-diene-1,3-dicarboxylate.
| Compound Name | dimethyl (1S,2S)-4-methyl-2-[(2-methyl-5-nitroimidazol-1-yl)methyl]-6-morpholin-4-ylcyclohexa-3,5-diene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101027500 |
| Molecular Formula | C20H26N4O7 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | dimethyl (1S,2S)-4-methyl-2-[(2-methyl-5-nitroimidazol-1-yl)methyl]-6-morpholin-4-ylcyclohexa-3,5-diene-1,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C)C=C(N2CCOCC2)[C@@H](C(=O)OC)[C@@H]1Cn1c([N+](=O)[O-])cnc1C |
| InChI | InChI=1S/C20H26N4O7/c1-12-9-15(22-5-7-31-8-6-22)18(20(26)30-4)14(17(12)19(25)29-3)11-23-13(2)21-10-16(23)24(27)28/h9-10,14,18H,5-8,11H2,1-4H3/t14-,18+/m1/s1 |
| InChIKey | NZOUMDIZEHFNDN-KDOFPFPSSA-N |
| XLogP | 1.22 |
| TPSA | 126.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|