C26H18N3O4S+ — CID 101028616
4-[4-(2,2-dicyanoethenyl)phenyl]-2-(4-methoxyphenyl)-3-pyridin-1-ium-1-ylcyclobuta-1,3-diene-1-sulfonic acid (PubChem CID 101028616) has the molecular formula C26H18N3O4S+ and a molecular weight of 468.51 g/mol. Its IUPAC name is 4-[4-(2,2-dicyanoethenyl)phenyl]-2-(4-methoxyphenyl)-3-pyridin-1-ium-1-ylcyclobuta-1,3-diene-1-sulfonic acid.
| Compound Name | 4-[4-(2,2-dicyanoethenyl)phenyl]-2-(4-methoxyphenyl)-3-pyridin-1-ium-1-ylcyclobuta-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 101028616 |
| Molecular Formula | C26H18N3O4S+ |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 4-[4-(2,2-dicyanoethenyl)phenyl]-2-(4-methoxyphenyl)-3-pyridin-1-ium-1-ylcyclobuta-1,3-diene-1-sulfonic acid |
| SMILES | COc1ccc(C2=C(S(=O)(=O)O)C(c3ccc(C=C(C#N)C#N)cc3)=C2[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C26H17N3O4S/c1-33-22-11-9-21(10-12-22)24-25(29-13-3-2-4-14-29)23(26(24)34(30,31)32)20-7-5-18(6-8-20)15-19(16-27)17-28/h2-15H,1H3/p+1 |
| InChIKey | HQXVEPAELXIBRV-UHFFFAOYSA-O |
| XLogP | 4.09 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|