C22H24O2 — CID 101034362
ethyl (E)-2-methyl-3-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)prop-2-enoate (PubChem CID 101034362) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is ethyl (E)-2-methyl-3-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)prop-2-enoate.
| Compound Name | ethyl (E)-2-methyl-3-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)prop-2-enoate |
|---|---|
| PubChem CID | 101034362 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | ethyl (E)-2-methyl-3-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1cc2ccc1CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C22H24O2/c1-3-24-22(23)16(2)14-21-15-19-9-8-17-4-6-18(7-5-17)10-12-20(21)13-11-19/h4-7,11,13-15H,3,8-10,12H2,1-2H3/b16-14+ |
| InChIKey | LJADNHJOVUWLCM-JQIJEIRASA-N |
| XLogP | 4.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|