C33H32O10S2 — CID 101035179
[2,5-bis[(4-ethylsulfonylbenzoyl)oxy]phenyl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 101035179) has the molecular formula C33H32O10S2 and a molecular weight of 652.74 g/mol. Its IUPAC name is [2,5-bis[(4-ethylsulfonylbenzoyl)oxy]phenyl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2,5-bis[(4-ethylsulfonylbenzoyl)oxy]phenyl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 101035179 |
| Molecular Formula | C33H32O10S2 |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.14 |
| IUPAC Name | [2,5-bis[(4-ethylsulfonylbenzoyl)oxy]phenyl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCS(=O)(=O)c1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(S(=O)(=O)CC)cc3)c(COC(=O)C3CC4C=CC3C4)c2)cc1 |
| InChI | InChI=1S/C33H32O10S2/c1-3-44(37,38)27-12-7-22(8-13-27)31(34)42-26-11-16-30(43-32(35)23-9-14-28(15-10-23)45(39,40)4-2)25(19-26)20-41-33(36)29-18-21-5-6-24(29)17-21/h5-16,19,21,24,29H,3-4,17-18,20H2,1-2H3 |
| InChIKey | XUGGYXWHUJHWHR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 147.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|