C47H60O12 — CID 101038904
[2,5-bis[[4-[5-(2-ethoxyethoxy)pentoxy]benzoyl]oxy]phenyl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 101038904) has the molecular formula C47H60O12 and a molecular weight of 816.98 g/mol. Its IUPAC name is [2,5-bis[[4-[5-(2-ethoxyethoxy)pentoxy]benzoyl]oxy]phenyl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2,5-bis[[4-[5-(2-ethoxyethoxy)pentoxy]benzoyl]oxy]phenyl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 101038904 |
| Molecular Formula | C47H60O12 |
| Molecular Weight | 816.98 g/mol |
| Exact Mass | 816.41 |
| IUPAC Name | [2,5-bis[[4-[5-(2-ethoxyethoxy)pentoxy]benzoyl]oxy]phenyl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOCCOCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCOCCOCC)cc3)c(COC(=O)C3CC4C=CC3C4)c2)cc1 |
| InChI | InChI=1S/C47H60O12/c1-3-51-27-29-53-23-7-5-9-25-55-40-17-13-36(14-18-40)45(48)58-42-21-22-44(39(33-42)34-57-47(50)43-32-35-11-12-38(43)31-35)59-46(49)37-15-19-41(20-16-37)56-26-10-6-8-24-54-30-28-52-4-2/h11-22,33,35,38,43H,3-10,23-32,34H2,1-2H3 |
| InChIKey | ZBFFHXUIOICNHW-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.98 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|