C51H80O12Si6 — CID 100914830
[2,5-bis[[4-[4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butoxy]benzoyl]oxy]phenyl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 100914830) has the molecular formula C51H80O12Si6 and a molecular weight of 1053.70 g/mol. Its IUPAC name is [2,5-bis[[4-[4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butoxy]benzoyl]oxy]phenyl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2,5-bis[[4-[4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butoxy]benzoyl]oxy]phenyl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 100914830 |
| Molecular Formula | C51H80O12Si6 |
| Molecular Weight | 1053.70 g/mol |
| Exact Mass | 1052.43 |
| IUPAC Name | [2,5-bis[[4-[4-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butoxy]benzoyl]oxy]phenyl]methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C)cc3)c(COC(=O)C3CC4C=CC3C4)c2)cc1 |
| InChI | InChI=1S/C51H80O12Si6/c1-64(2,3)60-68(11,12)62-66(7,8)33-17-15-31-55-44-25-21-40(22-26-44)49(52)58-46-29-30-48(43(37-46)38-57-51(54)47-36-39-19-20-42(47)35-39)59-50(53)41-23-27-45(28-24-41)56-32-16-18-34-67(9,10)63-69(13,14)61-65(4,5)6/h19-30,37,39,42,47H,15-18,31-36,38H2,1-14H3 |
| InChIKey | ZESJBXRFPZCYRE-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1053.70 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|