About 2-deuterio-2,5,5-trimethyl-1-oxidopyrrolidin-1-ium
2-deuterio-2,5,5-trimethyl-1-oxidopyrrolidin-1-ium (PubChem CID 101037054) has the molecular formula C7H15NO
and a molecular weight of 130.21 g/mol. Its IUPAC name is 2-deuterio-2,5,5-trimethyl-1-oxidopyrrolidin-1-ium.
Analyze 2-deuterio-2,5,5-trimethyl-1-oxidopyrrolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuterio-2,5,5-trimethyl-1-oxidopyrrolidin-1-ium?
The IUPAC name of 2-deuterio-2,5,5-trimethyl-1-oxidopyrrolidin-1-ium (CID 101037054) is 2-deuterio-2,5,5-trimethyl-1-oxidopyrrolidin-1-ium.
What is the SMILES notation for 2-deuterio-2,5,5-trimethyl-1-oxidopyrrolidin-1-ium?
The canonical SMILES for 2-deuterio-2,5,5-trimethyl-1-oxidopyrrolidin-1-ium is [2H]C1(C)CCC(C)(C)[NH+]1[O-].
What is the InChIKey of 2-deuterio-2,5,5-trimethyl-1-oxidopyrrolidin-1-ium?
The InChIKey is XWCQVBDYYDMANJ-RAMDWTOOSA-N. The full InChI is InChI=1S/C7H15NO/c1-6-4-5-7(2,3)8(6)9/h6,8H,4-5H2,1-3H3/i6D.
What are the key properties of 2-deuterio-2,5,5-trimethyl-1-oxidopyrrolidin-1-ium?
2-deuterio-2,5,5-trimethyl-1-oxidopyrrolidin-1-ium has a molecular weight of 130.21 g/mol, XLogP of 0.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuterio-2,5,5-trimethyl-1-oxidopyrrolidin-1-ium is sourced from PubChem (CID 101037054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).