C12H15N — CID 101038180
(5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine (PubChem CID 101038180) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine.
| Compound Name | (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 101038180 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine |
| SMILES | C[C@]1(c2ccccc2)C=NCCC1 |
| InChI | InChI=1S/C12H15N/c1-12(8-5-9-13-10-12)11-6-3-2-4-7-11/h2-4,6-7,10H,5,8-9H2,1H3/t12-/m1/s1 |
| InChIKey | WSNLWPRGEGSFDU-GFCCVEGCSA-N |
| XLogP | 2.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |