About (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine
(5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine (PubChem CID 101038180) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine |
| PubChem CID | 101038180 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine |
| SMILES | C[C@]1(c2ccccc2)C=NCCC1 |
| InChI | InChI=1S/C12H15N/c1-12(8-5-9-13-10-12)11-6-3-2-4-7-11/h2-4,6-7,10H,5,8-9H2,1H3/t12-/m1/s1 |
| InChIKey | WSNLWPRGEGSFDU-GFCCVEGCSA-N |
| XLogP | 2.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine?
The IUPAC name of (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine (CID 101038180) is (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine?
The canonical SMILES for (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine is C[C@]1(c2ccccc2)C=NCCC1.
What is the InChIKey of (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine?
The InChIKey is WSNLWPRGEGSFDU-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H15N/c1-12(8-5-9-13-10-12)11-6-3-2-4-7-11/h2-4,6-7,10H,5,8-9H2,1H3/t12-/m1/s1.
What are the key properties of (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine?
(5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine has a molecular weight of 173.26 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-methyl-5-phenyl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 101038180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).