C12H8F6I2O6S2+2 — CID 101039933
[(E)-2-(trifluoromethylsulfonyloxy)ethenyl]-[4-[(E)-2-(trifluoromethylsulfonyloxy)ethenyl]iodoniophenyl]iodanium (PubChem CID 101039933) has the molecular formula C12H8F6I2O6S2+2 and a molecular weight of 680.12 g/mol. Its IUPAC name is [(E)-2-(trifluoromethylsulfonyloxy)ethenyl]-[4-[(E)-2-(trifluoromethylsulfonyloxy)ethenyl]iodoniophenyl]iodanium.
| Compound Name | [(E)-2-(trifluoromethylsulfonyloxy)ethenyl]-[4-[(E)-2-(trifluoromethylsulfonyloxy)ethenyl]iodoniophenyl]iodanium |
|---|---|
| PubChem CID | 101039933 |
| Molecular Formula | C12H8F6I2O6S2+2 |
| Molecular Weight | 680.12 g/mol |
| Exact Mass | 679.77 |
| IUPAC Name | [(E)-2-(trifluoromethylsulfonyloxy)ethenyl]-[4-[(E)-2-(trifluoromethylsulfonyloxy)ethenyl]iodoniophenyl]iodanium |
| SMILES | O=S(=O)(O/C=C/[I+]c1ccc([I+]/C=C/OS(=O)(=O)C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H8F6I2O6S2/c13-11(14,15)27(21,22)25-7-5-19-9-1-2-10(4-3-9)20-6-8-26-28(23,24)12(16,17)18/h1-8H/q+2/b7-5+,8-6+ |
| InChIKey | AVZBXFIGWPQREQ-KQQUZDAGSA-N |
| XLogP | -3.12 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.12 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|