C12H23N — CID 101040056
(2S,4aS,5R,8aR)-2-ethyl-5-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline (PubChem CID 101040056) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (2S,4aS,5R,8aR)-2-ethyl-5-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline.
| Compound Name | (2S,4aS,5R,8aR)-2-ethyl-5-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
|---|---|
| PubChem CID | 101040056 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (2S,4aS,5R,8aR)-2-ethyl-5-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
| SMILES | CC[C@H]1CC[C@H]2[C@H](C)CCC[C@H]2N1 |
| InChI | InChI=1S/C12H23N/c1-3-10-7-8-11-9(2)5-4-6-12(11)13-10/h9-13H,3-8H2,1-2H3/t9-,10+,11+,12-/m1/s1 |
| InChIKey | VZVXOVPQVUBUGW-NOOOWODRSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |