C19H37N — CID 85289021
2,5-dipentyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline (PubChem CID 85289021) has the molecular formula C19H37N and a molecular weight of 279.51 g/mol. Its IUPAC name is 2,5-dipentyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline.
| Compound Name | 2,5-dipentyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
|---|---|
| PubChem CID | 85289021 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | 2,5-dipentyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
| SMILES | CCCCCC1CCC2C(CCCCC)CCCC2N1 |
| InChI | InChI=1S/C19H37N/c1-3-5-7-10-16-11-9-13-19-18(16)15-14-17(20-19)12-8-6-4-2/h16-20H,3-15H2,1-2H3 |
| InChIKey | CJSYBWABORNZIX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|