C14H25NO — CID 11368080
(4aR,5S,8aS)-5-pentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one (PubChem CID 11368080) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (4aR,5S,8aS)-5-pentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one.
| Compound Name | (4aR,5S,8aS)-5-pentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 11368080 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (4aR,5S,8aS)-5-pentyl-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one |
| SMILES | CCCCC[C@H]1CCC[C@@H]2NC(=O)CC[C@H]12 |
| InChI | InChI=1S/C14H25NO/c1-2-3-4-6-11-7-5-8-13-12(11)9-10-14(16)15-13/h11-13H,2-10H2,1H3,(H,15,16)/t11-,12+,13-/m0/s1 |
| InChIKey | JUFAYHRRHLHERX-XQQFMLRXSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|