C13H22O2 — CID 91238755
3-pentylcyclohexane-1,2-dicarbaldehyde (PubChem CID 91238755) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-pentylcyclohexane-1,2-dicarbaldehyde.
| Compound Name | 3-pentylcyclohexane-1,2-dicarbaldehyde |
|---|---|
| PubChem CID | 91238755 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 3-pentylcyclohexane-1,2-dicarbaldehyde |
| SMILES | CCCCCC1CCCC(C=O)C1C=O |
| InChI | InChI=1S/C13H22O2/c1-2-3-4-6-11-7-5-8-12(9-14)13(11)10-15/h9-13H,2-8H2,1H3 |
| InChIKey | FRQNQEWVPDGOEF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|