C21H19N2O4+ — CID 101040624
2-methoxy-4-[2-[1-[(2-nitrophenyl)methyl]-1H-pyridin-1-ium-4-ylidene]ethylidene]cyclohexa-2,5-dien-1-one (PubChem CID 101040624) has the molecular formula C21H19N2O4+ and a molecular weight of 363.39 g/mol. Its IUPAC name is 2-methoxy-4-[2-[1-[(2-nitrophenyl)methyl]-1H-pyridin-1-ium-4-ylidene]ethylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2-methoxy-4-[2-[1-[(2-nitrophenyl)methyl]-1H-pyridin-1-ium-4-ylidene]ethylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 101040624 |
| Molecular Formula | C21H19N2O4+ |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-methoxy-4-[2-[1-[(2-nitrophenyl)methyl]-1H-pyridin-1-ium-4-ylidene]ethylidene]cyclohexa-2,5-dien-1-one |
| SMILES | COC1=CC(=CC=C2C=C[NH+](Cc3ccccc3[N+](=O)[O-])C=C2)C=CC1=O |
| InChI | InChI=1S/C21H18N2O4/c1-27-21-14-17(8-9-20(21)24)7-6-16-10-12-22(13-11-16)15-18-4-2-3-5-19(18)23(25)26/h2-14H,15H2,1H3/p+1 |
| InChIKey | BBKVPKIYIADYBF-UHFFFAOYSA-O |
| XLogP | 2.54 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|