C27H27BrN2O8 — CID 101041880
9H-fluoren-9-ylmethyl (2S)-2-[(E,1R,2S)-4-acetamido-2-acetyloxy-3-bromo-1-hydroxy-5-methoxy-5-oxopent-3-enyl]aziridine-1-carboxylate (PubChem CID 101041880) has the molecular formula C27H27BrN2O8 and a molecular weight of 587.42 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2S)-2-[(E,1R,2S)-4-acetamido-2-acetyloxy-3-bromo-1-hydroxy-5-methoxy-5-oxopent-3-enyl]aziridine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2S)-2-[(E,1R,2S)-4-acetamido-2-acetyloxy-3-bromo-1-hydroxy-5-methoxy-5-oxopent-3-enyl]aziridine-1-carboxylate |
|---|---|
| PubChem CID | 101041880 |
| Molecular Formula | C27H27BrN2O8 |
| Molecular Weight | 587.42 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2S)-2-[(E,1R,2S)-4-acetamido-2-acetyloxy-3-bromo-1-hydroxy-5-methoxy-5-oxopent-3-enyl]aziridine-1-carboxylate |
| SMILES | COC(=O)/C(NC(C)=O)=C(\Br)[C@@H](OC(C)=O)[C@H](O)[C@@H]1CN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H27BrN2O8/c1-14(31)29-23(26(34)36-3)22(28)25(38-15(2)32)24(33)21-12-30(21)27(35)37-13-20-18-10-6-4-8-16(18)17-9-5-7-11-19(17)20/h4-11,20-21,24-25,33H,12-13H2,1-3H3,(H,29,31)/b23-22+/t21-,24+,25+,30?/m0/s1 |
| InChIKey | HWBPDRUSYLMYIH-WFXIVSDASA-N |
| XLogP | 2.83 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|