C29H33N3O6 — CID 101042308
N-cyclohexyl-N-(cyclohexylcarbamoyl)-7-nitro-1-oxo-3-phenyl-3,4-dihydroisochromene-4-carboxamide (PubChem CID 101042308) has the molecular formula C29H33N3O6 and a molecular weight of 519.60 g/mol. Its IUPAC name is N-cyclohexyl-N-(cyclohexylcarbamoyl)-7-nitro-1-oxo-3-phenyl-3,4-dihydroisochromene-4-carboxamide.
| Compound Name | N-cyclohexyl-N-(cyclohexylcarbamoyl)-7-nitro-1-oxo-3-phenyl-3,4-dihydroisochromene-4-carboxamide |
|---|---|
| PubChem CID | 101042308 |
| Molecular Formula | C29H33N3O6 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | N-cyclohexyl-N-(cyclohexylcarbamoyl)-7-nitro-1-oxo-3-phenyl-3,4-dihydroisochromene-4-carboxamide |
| SMILES | O=C1OC(c2ccccc2)C(C(=O)N(C(=O)NC2CCCCC2)C2CCCCC2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C29H33N3O6/c33-27(31(21-14-8-3-9-15-21)29(35)30-20-12-6-2-7-13-20)25-23-17-16-22(32(36)37)18-24(23)28(34)38-26(25)19-10-4-1-5-11-19/h1,4-5,10-11,16-18,20-21,25-26H,2-3,6-9,12-15H2,(H,30,35) |
| InChIKey | UHEMQUBYJWJZIP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|