C27H24ClN3O4 — CID 154709289
1-(4-chlorophenyl)-N-cyclohexyl-5-nitro-3-oxo-2-phenylisoindole-1-carboxamide (PubChem CID 154709289) has the molecular formula C27H24ClN3O4 and a molecular weight of 489.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-cyclohexyl-5-nitro-3-oxo-2-phenylisoindole-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-cyclohexyl-5-nitro-3-oxo-2-phenylisoindole-1-carboxamide |
|---|---|
| PubChem CID | 154709289 |
| Molecular Formula | C27H24ClN3O4 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 1-(4-chlorophenyl)-N-cyclohexyl-5-nitro-3-oxo-2-phenylisoindole-1-carboxamide |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2C(C(=O)NC2CCCCC2)(c2ccc(Cl)cc2)N1c1ccccc1 |
| InChI | InChI=1S/C27H24ClN3O4/c28-19-13-11-18(12-14-19)27(26(33)29-20-7-3-1-4-8-20)24-16-15-22(31(34)35)17-23(24)25(32)30(27)21-9-5-2-6-10-21/h2,5-6,9-17,20H,1,3-4,7-8H2,(H,29,33) |
| InChIKey | MTSPCZZUPMUPCO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|