C26H27ClN2O3 — CID 102492376
(4E)-4-benzylidene-2-(4-chlorobenzoyl)-N-cyclohexyl-1-methyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 102492376) has the molecular formula C26H27ClN2O3 and a molecular weight of 450.97 g/mol. Its IUPAC name is (4E)-4-benzylidene-2-(4-chlorobenzoyl)-N-cyclohexyl-1-methyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (4E)-4-benzylidene-2-(4-chlorobenzoyl)-N-cyclohexyl-1-methyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 102492376 |
| Molecular Formula | C26H27ClN2O3 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | (4E)-4-benzylidene-2-(4-chlorobenzoyl)-N-cyclohexyl-1-methyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | CN1C(=O)/C(=C/c2ccccc2)CC1(C(=O)NC1CCCCC1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H27ClN2O3/c1-29-24(31)20(16-18-8-4-2-5-9-18)17-26(29,23(30)19-12-14-21(27)15-13-19)25(32)28-22-10-6-3-7-11-22/h2,4-5,8-9,12-16,22H,3,6-7,10-11,17H2,1H3,(H,28,32)/b20-16+ |
| InChIKey | NEUJUAWXIKKDKF-CAPFRKAQSA-N |
| XLogP | 4.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|