C16H21N3O3 — CID 101042918
1-(2-nitroindol-1-yl)-3-piperidin-1-ylpropan-2-ol (PubChem CID 101042918) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-(2-nitroindol-1-yl)-3-piperidin-1-ylpropan-2-ol.
| Compound Name | 1-(2-nitroindol-1-yl)-3-piperidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 101042918 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-(2-nitroindol-1-yl)-3-piperidin-1-ylpropan-2-ol |
| SMILES | O=[N+]([O-])c1cc2ccccc2n1CC(O)CN1CCCCC1 |
| InChI | InChI=1S/C16H21N3O3/c20-14(11-17-8-4-1-5-9-17)12-18-15-7-3-2-6-13(15)10-16(18)19(21)22/h2-3,6-7,10,14,20H,1,4-5,8-9,11-12H2 |
| InChIKey | UPWBAMZYISBDEL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|