C28H29ClO4 — CID 101044147
2-chloro-1,4-bis[4-(3-ethenoxypropoxy)phenyl]benzene (PubChem CID 101044147) has the molecular formula C28H29ClO4 and a molecular weight of 464.99 g/mol. Its IUPAC name is 2-chloro-1,4-bis[4-(3-ethenoxypropoxy)phenyl]benzene.
| Compound Name | 2-chloro-1,4-bis[4-(3-ethenoxypropoxy)phenyl]benzene |
|---|---|
| PubChem CID | 101044147 |
| Molecular Formula | C28H29ClO4 |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-chloro-1,4-bis[4-(3-ethenoxypropoxy)phenyl]benzene |
| SMILES | C=COCCCOc1ccc(-c2ccc(-c3ccc(OCCCOC=C)cc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C28H29ClO4/c1-3-30-17-5-19-32-25-12-7-22(8-13-25)24-11-16-27(28(29)21-24)23-9-14-26(15-10-23)33-20-6-18-31-4-2/h3-4,7-16,21H,1-2,5-6,17-20H2 |
| InChIKey | FPQVPAWUOKHWAI-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|