C36H36O4 — CID 23527554
2-[4-(1-ethenoxypropoxy)phenyl]-7-[4-(3-ethenoxypropoxy)phenyl]-9-methyl-9H-fluorene (PubChem CID 23527554) has the molecular formula C36H36O4 and a molecular weight of 532.68 g/mol. Its IUPAC name is 2-[4-(1-ethenoxypropoxy)phenyl]-7-[4-(3-ethenoxypropoxy)phenyl]-9-methyl-9H-fluorene.
| Compound Name | 2-[4-(1-ethenoxypropoxy)phenyl]-7-[4-(3-ethenoxypropoxy)phenyl]-9-methyl-9H-fluorene |
|---|---|
| PubChem CID | 23527554 |
| Molecular Formula | C36H36O4 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 2-[4-(1-ethenoxypropoxy)phenyl]-7-[4-(3-ethenoxypropoxy)phenyl]-9-methyl-9H-fluorene |
| SMILES | C=COCCCOc1ccc(-c2ccc3c(c2)C(C)c2cc(-c4ccc(OC(CC)OC=C)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C36H36O4/c1-5-36(38-7-3)40-31-17-11-27(12-18-31)29-14-20-33-32-19-13-28(23-34(32)25(4)35(33)24-29)26-9-15-30(16-10-26)39-22-8-21-37-6-2/h6-7,9-20,23-25,36H,2-3,5,8,21-22H2,1,4H3 |
| InChIKey | ICIXEBIMLWOQEY-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|