C39H38O6 — CID 23527484
3-[4-[9-ethyl-7-[4-(1-prop-2-enoyloxypropoxy)phenyl]-9H-fluoren-2-yl]phenoxy]propyl prop-2-enoate (PubChem CID 23527484) has the molecular formula C39H38O6 and a molecular weight of 602.73 g/mol. Its IUPAC name is 3-[4-[9-ethyl-7-[4-(1-prop-2-enoyloxypropoxy)phenyl]-9H-fluoren-2-yl]phenoxy]propyl prop-2-enoate.
| Compound Name | 3-[4-[9-ethyl-7-[4-(1-prop-2-enoyloxypropoxy)phenyl]-9H-fluoren-2-yl]phenoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 23527484 |
| Molecular Formula | C39H38O6 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 3-[4-[9-ethyl-7-[4-(1-prop-2-enoyloxypropoxy)phenyl]-9H-fluoren-2-yl]phenoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc(-c2ccc3c(c2)C(CC)c2cc(-c4ccc(OC(CC)OC(=O)C=C)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C39H38O6/c1-5-32-35-24-28(26-10-16-30(17-11-26)42-22-9-23-43-37(40)6-2)14-20-33(35)34-21-15-29(25-36(32)34)27-12-18-31(19-13-27)44-39(8-4)45-38(41)7-3/h6-7,10-21,24-25,32,39H,2-3,5,8-9,22-23H2,1,4H3 |
| InChIKey | ZTJNGAISURCFLN-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|