C18H29N5O5 — CID 101044481
(3S,9S,12S,15R)-3,6,6,9,12-pentamethyl-1,4,7,10,13-pentazabicyclo[13.3.0]octadecane-2,5,8,11,14-pentone (PubChem CID 101044481) has the molecular formula C18H29N5O5 and a molecular weight of 395.46 g/mol. Its IUPAC name is (3S,9S,12S,15R)-3,6,6,9,12-pentamethyl-1,4,7,10,13-pentazabicyclo[13.3.0]octadecane-2,5,8,11,14-pentone.
| Compound Name | (3S,9S,12S,15R)-3,6,6,9,12-pentamethyl-1,4,7,10,13-pentazabicyclo[13.3.0]octadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 101044481 |
| Molecular Formula | C18H29N5O5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | (3S,9S,12S,15R)-3,6,6,9,12-pentamethyl-1,4,7,10,13-pentazabicyclo[13.3.0]octadecane-2,5,8,11,14-pentone |
| SMILES | C[C@@H]1NC(=O)[C@H](C)NC(=O)[C@H]2CCCN2C(=O)[C@H](C)NC(=O)C(C)(C)NC1=O |
| InChI | InChI=1S/C18H29N5O5/c1-9-13(24)19-10(2)14(25)22-18(4,5)17(28)21-11(3)16(27)23-8-6-7-12(23)15(26)20-9/h9-12H,6-8H2,1-5H3,(H,19,24)(H,20,26)(H,21,28)(H,22,25)/t9-,10-,11-,12+/m0/s1 |
| InChIKey | AKMIASVHJADXOH-FIQHERPVSA-N |
| XLogP | -1.60 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |