C8H14N3O2+ — CID 7161708
(3S,9aR)-3-methyl-3,6,7,8,9,9a-hexahydro-2H-pyrazino[1,2-a]pyrazin-8-ium-1,4-dione (PubChem CID 7161708) has the molecular formula C8H14N3O2+ and a molecular weight of 184.22 g/mol. Its IUPAC name is (3S,9aR)-3-methyl-3,6,7,8,9,9a-hexahydro-2H-pyrazino[1,2-a]pyrazin-8-ium-1,4-dione.
| Compound Name | (3S,9aR)-3-methyl-3,6,7,8,9,9a-hexahydro-2H-pyrazino[1,2-a]pyrazin-8-ium-1,4-dione |
|---|---|
| PubChem CID | 7161708 |
| Molecular Formula | C8H14N3O2+ |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (3S,9aR)-3-methyl-3,6,7,8,9,9a-hexahydro-2H-pyrazino[1,2-a]pyrazin-8-ium-1,4-dione |
| SMILES | C[C@@H]1NC(=O)[C@H]2C[NH2+]CCN2C1=O |
| InChI | InChI=1S/C8H13N3O2/c1-5-8(13)11-3-2-9-4-6(11)7(12)10-5/h5-6,9H,2-4H2,1H3,(H,10,12)/p+1/t5-,6+/m0/s1 |
| InChIKey | PJJLVZOKOWVMLN-NTSWFWBYSA-O |
| XLogP | -2.72 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |