C12H17NO — CID 101044971
(1S,2S,3R,6S,12S)-5-methyl-4-oxa-5-azatetracyclo[8.3.0.02,6.03,12]tridec-10-ene (PubChem CID 101044971) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (1S,2S,3R,6S,12S)-5-methyl-4-oxa-5-azatetracyclo[8.3.0.02,6.03,12]tridec-10-ene.
| Compound Name | (1S,2S,3R,6S,12S)-5-methyl-4-oxa-5-azatetracyclo[8.3.0.02,6.03,12]tridec-10-ene |
|---|---|
| PubChem CID | 101044971 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (1S,2S,3R,6S,12S)-5-methyl-4-oxa-5-azatetracyclo[8.3.0.02,6.03,12]tridec-10-ene |
| SMILES | CN1O[C@@H]2C3C=C4CCC[C@H]1[C@@H]2[C@@H]4C3 |
| InChI | InChI=1S/C12H17NO/c1-13-10-4-2-3-7-5-8-6-9(7)11(10)12(8)14-13/h5,8-12H,2-4,6H2,1H3/t8?,9-,10+,11+,12-/m1/s1 |
| InChIKey | LRHOFSCCECUPSD-FXNBZEQJSA-N |
| XLogP | 1.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|