C14H20 — CID 175558518
5-methylidene-1,2,3,4,4a,4b,6,7,8,9a-decahydrofluorene (PubChem CID 175558518) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 5-methylidene-1,2,3,4,4a,4b,6,7,8,9a-decahydrofluorene.
| Compound Name | 5-methylidene-1,2,3,4,4a,4b,6,7,8,9a-decahydrofluorene |
|---|---|
| PubChem CID | 175558518 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 5-methylidene-1,2,3,4,4a,4b,6,7,8,9a-decahydrofluorene |
| SMILES | C=C1CCCC2=CC3CCCCC3C12 |
| InChI | InChI=1S/C14H20/c1-10-5-4-7-12-9-11-6-2-3-8-13(11)14(10)12/h9,11,13-14H,1-8H2 |
| InChIKey | ALCHYJLXAINFND-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|