C11H12O — CID 11819332
(3R,11R)-tricyclo[4.4.1.03,11]undeca-1,5-dien-7-one (PubChem CID 11819332) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is (3R,11R)-tricyclo[4.4.1.03,11]undeca-1,5-dien-7-one.
| Compound Name | (3R,11R)-tricyclo[4.4.1.03,11]undeca-1,5-dien-7-one |
|---|---|
| PubChem CID | 11819332 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (3R,11R)-tricyclo[4.4.1.03,11]undeca-1,5-dien-7-one |
| SMILES | O=C1CCCC2=C[C@H]3CC=C1[C@@H]23 |
| InChI | InChI=1S/C11H12O/c12-10-3-1-2-7-6-8-4-5-9(10)11(7)8/h5-6,8,11H,1-4H2/t8-,11+/m1/s1 |
| InChIKey | IDCMHYWPXVMKAP-KCJUWKMLSA-N |
| XLogP | 2.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|