C9H19NNaO5P — CID 101045889
sodium N-[diethoxy(oxido)phosphaniumyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate (PubChem CID 101045889) has the molecular formula C9H19NNaO5P and a molecular weight of 275.22 g/mol. Its IUPAC name is sodium N-[diethoxy(oxido)phosphaniumyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate.
| Compound Name | sodium N-[diethoxy(oxido)phosphaniumyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
|---|---|
| PubChem CID | 101045889 |
| Molecular Formula | C9H19NNaO5P |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | sodium N-[diethoxy(oxido)phosphaniumyl]-1-[(2-methylpropan-2-yl)oxy]methanimidate |
| SMILES | CCO[P+]([O-])(N=C([O-])OC(C)(C)C)OCC.[Na+] |
| InChI | InChI=1S/C9H20NO5P.Na/c1-6-13-16(12,14-7-2)10-8(11)15-9(3,4)5;/h6-7H2,1-5H3,(H,10,11,12);/q;+1/p-1 |
| InChIKey | NQUWBFQFXGFYCJ-UHFFFAOYSA-M |
| XLogP | -2.37 |
| TPSA | 86.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|