C9H16LiNO2 — CID 101354915
lithium N-but-3-en-2-yl-1-[(2-methylpropan-2-yl)oxy]methanimidate (PubChem CID 101354915) has the molecular formula C9H16LiNO2 and a molecular weight of 177.17 g/mol. Its IUPAC name is lithium N-but-3-en-2-yl-1-[(2-methylpropan-2-yl)oxy]methanimidate.
| Compound Name | lithium N-but-3-en-2-yl-1-[(2-methylpropan-2-yl)oxy]methanimidate |
|---|---|
| PubChem CID | 101354915 |
| Molecular Formula | C9H16LiNO2 |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | lithium N-but-3-en-2-yl-1-[(2-methylpropan-2-yl)oxy]methanimidate |
| SMILES | C=CC(C)/N=C(\[O-])OC(C)(C)C.[Li+] |
| InChI | InChI=1S/C9H17NO2.Li/c1-6-7(2)10-8(11)12-9(3,4)5;/h6-7H,1H2,2-5H3,(H,10,11);/q;+1/p-1 |
| InChIKey | PKNWTTHXFIXHGL-UHFFFAOYSA-M |
| XLogP | -1.90 |
| TPSA | 44.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|