C25H52O6Si2 — CID 101046282
[(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (3R)-3-methylpentanoate (PubChem CID 101046282) has the molecular formula C25H52O6Si2 and a molecular weight of 504.86 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (3R)-3-methylpentanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (3R)-3-methylpentanoate |
|---|---|
| PubChem CID | 101046282 |
| Molecular Formula | C25H52O6Si2 |
| Molecular Weight | 504.86 g/mol |
| Exact Mass | 504.33 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (3R)-3-methylpentanoate |
| SMILES | CC[C@@H](C)CC(=O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC)O[C@@H]1C |
| InChI | InChI=1S/C25H52O6Si2/c1-15-17(2)16-19(26)29-20-18(3)28-23(27-10)22(31-33(13,14)25(7,8)9)21(20)30-32(11,12)24(4,5)6/h17-18,20-23H,15-16H2,1-14H3/t17-,18-,20-,21+,22-,23+/m1/s1 |
| InChIKey | DUXUGXVECMCZDW-OMIWWWDHSA-N |
| XLogP | 6.51 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.86 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|