C17H22N2O2 — CID 101048753
2-(2,2-dimethyl-3-oxido-5-phenylimidazol-3-ium-4-yl)hex-5-en-2-ol (PubChem CID 101048753) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3-oxido-5-phenylimidazol-3-ium-4-yl)hex-5-en-2-ol.
| Compound Name | 2-(2,2-dimethyl-3-oxido-5-phenylimidazol-3-ium-4-yl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 101048753 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-(2,2-dimethyl-3-oxido-5-phenylimidazol-3-ium-4-yl)hex-5-en-2-ol |
| SMILES | C=CCCC(C)(O)C1=[N+]([O-])C(C)(C)N=C1c1ccccc1 |
| InChI | InChI=1S/C17H22N2O2/c1-5-6-12-17(4,20)15-14(13-10-8-7-9-11-13)18-16(2,3)19(15)21/h5,7-11,20H,1,6,12H2,2-4H3 |
| InChIKey | KQMRTFUJFZUAIV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|