About 4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide
4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide (PubChem CID 101049926) has the molecular formula C11H18N4O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide |
| PubChem CID | 101049926 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(CNC2=NCC(=O)N2)CC1 |
| InChI | InChI=1S/C11H18N4O2/c12-10(17)8-3-1-7(2-4-8)5-13-11-14-6-9(16)15-11/h7-8H,1-6H2,(H2,12,17)(H2,13,14,15,16) |
| InChIKey | RGZPHJLDXDFXJJ-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide?
The IUPAC name of 4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide (CID 101049926) is 4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide.
What is the SMILES notation for 4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide?
The canonical SMILES for 4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide is NC(=O)C1CCC(CNC2=NCC(=O)N2)CC1.
What is the InChIKey of 4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide?
The InChIKey is RGZPHJLDXDFXJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2/c12-10(17)8-3-1-7(2-4-8)5-13-11-14-6-9(16)15-11/h7-8H,1-6H2,(H2,12,17)(H2,13,14,15,16).
What are the key properties of 4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide?
4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide has a molecular weight of 238.29 g/mol, XLogP of -0.65, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(5-oxo-1,4-dihydroimidazol-2-yl)amino]methyl]cyclohexane-1-carboxamide is sourced from PubChem (CID 101049926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).