C11H5F5N2O2 — CID 101052894
1-methyl-5-(2,3,4,5,6-pentafluorophenyl)pyrimidine-2,4-dione (PubChem CID 101052894) has the molecular formula C11H5F5N2O2 and a molecular weight of 292.16 g/mol. Its IUPAC name is 1-methyl-5-(2,3,4,5,6-pentafluorophenyl)pyrimidine-2,4-dione.
| Compound Name | 1-methyl-5-(2,3,4,5,6-pentafluorophenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101052894 |
| Molecular Formula | C11H5F5N2O2 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 1-methyl-5-(2,3,4,5,6-pentafluorophenyl)pyrimidine-2,4-dione |
| SMILES | Cn1cc(-c2c(F)c(F)c(F)c(F)c2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H5F5N2O2/c1-18-2-3(10(19)17-11(18)20)4-5(12)7(14)9(16)8(15)6(4)13/h2H,1H3,(H,17,19,20) |
| InChIKey | RUZVBCLFZHJBCA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|