C25H37NO5S — CID 101054650
N,N-di(propan-2-yl)-1-[(1'S,2S,4S,4'R)-4,7',7'-trimethyl-5-oxo-4-phenylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]methanesulfonamide (PubChem CID 101054650) has the molecular formula C25H37NO5S and a molecular weight of 463.64 g/mol. Its IUPAC name is N,N-di(propan-2-yl)-1-[(1'S,2S,4S,4'R)-4,7',7'-trimethyl-5-oxo-4-phenylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]methanesulfonamide.
| Compound Name | N,N-di(propan-2-yl)-1-[(1'S,2S,4S,4'R)-4,7',7'-trimethyl-5-oxo-4-phenylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]methanesulfonamide |
|---|---|
| PubChem CID | 101054650 |
| Molecular Formula | C25H37NO5S |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | N,N-di(propan-2-yl)-1-[(1'S,2S,4S,4'R)-4,7',7'-trimethyl-5-oxo-4-phenylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]methanesulfonamide |
| SMILES | CC(C)N(C(C)C)S(=O)(=O)C[C@]12CC[C@H](C[C@]13OC(=O)[C@](C)(c1ccccc1)O3)C2(C)C |
| InChI | InChI=1S/C25H37NO5S/c1-17(2)26(18(3)4)32(28,29)16-24-14-13-20(22(24,5)6)15-25(24)30-21(27)23(7,31-25)19-11-9-8-10-12-19/h8-12,17-18,20H,13-16H2,1-7H3/t20-,23+,24+,25-/m1/s1 |
| InChIKey | WMFGBZHYXFTCHW-AKAGGGOCSA-N |
| XLogP | 4.45 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |