C25H37NO5S — CID 59103228
(5S)-1'-[(dipropylamino)peroxysulfanylmethyl]-5,7',7'-trimethyl-5-phenylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-one (PubChem CID 59103228) has the molecular formula C25H37NO5S and a molecular weight of 463.64 g/mol. Its IUPAC name is (5S)-1'-[(dipropylamino)peroxysulfanylmethyl]-5,7',7'-trimethyl-5-phenylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-one.
| Compound Name | (5S)-1'-[(dipropylamino)peroxysulfanylmethyl]-5,7',7'-trimethyl-5-phenylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-one |
|---|---|
| PubChem CID | 59103228 |
| Molecular Formula | C25H37NO5S |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | (5S)-1'-[(dipropylamino)peroxysulfanylmethyl]-5,7',7'-trimethyl-5-phenylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-one |
| SMILES | CCCN(CCC)OOSCC12CCC(CC13OC(=O)[C@](C)(c1ccccc1)O3)C2(C)C |
| InChI | InChI=1S/C25H37NO5S/c1-6-15-26(16-7-2)30-31-32-18-24-14-13-20(22(24,3)4)17-25(24)28-21(27)23(5,29-25)19-11-9-8-10-12-19/h8-12,20H,6-7,13-18H2,1-5H3/t20?,23-,24?,25?/m0/s1 |
| InChIKey | KFBMTOZGKWPEAA-LRNALIEASA-N |
| XLogP | 5.63 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|