C27H39NO5S — CID 59103234
(5S)-1'-[(dipropylamino)peroxysulfanylmethyl]-7',7'-dimethyl-5-phenyl-5-prop-2-enylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-one (PubChem CID 59103234) has the molecular formula C27H39NO5S and a molecular weight of 489.68 g/mol. Its IUPAC name is (5S)-1'-[(dipropylamino)peroxysulfanylmethyl]-7',7'-dimethyl-5-phenyl-5-prop-2-enylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-one.
| Compound Name | (5S)-1'-[(dipropylamino)peroxysulfanylmethyl]-7',7'-dimethyl-5-phenyl-5-prop-2-enylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-one |
|---|---|
| PubChem CID | 59103234 |
| Molecular Formula | C27H39NO5S |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | (5S)-1'-[(dipropylamino)peroxysulfanylmethyl]-7',7'-dimethyl-5-phenyl-5-prop-2-enylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-one |
| SMILES | C=CC[C@@]1(c2ccccc2)OC2(CC3CCC2(CSOON(CCC)CCC)C3(C)C)OC1=O |
| InChI | InChI=1S/C27H39NO5S/c1-6-15-26(21-12-10-9-11-13-21)23(29)30-27(31-26)19-22-14-16-25(27,24(22,4)5)20-34-33-32-28(17-7-2)18-8-3/h6,9-13,22H,1,7-8,14-20H2,2-5H3/t22?,25?,26-,27?/m0/s1 |
| InChIKey | QTXBMBHSNKPAJY-RAZDXMRRSA-N |
| XLogP | 6.19 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|