C26H39NO5S — CID 101054649
1-[(1'S,2S,4R,4'R)-4-benzyl-4,7',7'-trimethyl-5-oxospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-di(propan-2-yl)methanesulfonamide (PubChem CID 101054649) has the molecular formula C26H39NO5S and a molecular weight of 477.67 g/mol. Its IUPAC name is 1-[(1'S,2S,4R,4'R)-4-benzyl-4,7',7'-trimethyl-5-oxospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-di(propan-2-yl)methanesulfonamide.
| Compound Name | 1-[(1'S,2S,4R,4'R)-4-benzyl-4,7',7'-trimethyl-5-oxospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-di(propan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 101054649 |
| Molecular Formula | C26H39NO5S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 1-[(1'S,2S,4R,4'R)-4-benzyl-4,7',7'-trimethyl-5-oxospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-di(propan-2-yl)methanesulfonamide |
| SMILES | CC(C)N(C(C)C)S(=O)(=O)C[C@]12CC[C@H](C[C@]13OC(=O)[C@@](C)(Cc1ccccc1)O3)C2(C)C |
| InChI | InChI=1S/C26H39NO5S/c1-18(2)27(19(3)4)33(29,30)17-25-14-13-21(23(25,5)6)16-26(25)31-22(28)24(7,32-26)15-20-11-9-8-10-12-20/h8-12,18-19,21H,13-17H2,1-7H3/t21-,24-,25+,26-/m1/s1 |
| InChIKey | RQKXBXVTSWUYHQ-ATPOPXNDSA-N |
| XLogP | 4.53 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |