C26H39NO5S — CID 59103221
(5R)-5-benzyl-1'-[(dipropylamino)peroxysulfanylmethyl]-5,7',7'-trimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-one (PubChem CID 59103221) has the molecular formula C26H39NO5S and a molecular weight of 477.67 g/mol. Its IUPAC name is (5R)-5-benzyl-1'-[(dipropylamino)peroxysulfanylmethyl]-5,7',7'-trimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-one.
| Compound Name | (5R)-5-benzyl-1'-[(dipropylamino)peroxysulfanylmethyl]-5,7',7'-trimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-one |
|---|---|
| PubChem CID | 59103221 |
| Molecular Formula | C26H39NO5S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | (5R)-5-benzyl-1'-[(dipropylamino)peroxysulfanylmethyl]-5,7',7'-trimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-one |
| SMILES | CCCN(CCC)OOSCC12CCC(CC13OC(=O)[C@@](C)(Cc1ccccc1)O3)C2(C)C |
| InChI | InChI=1S/C26H39NO5S/c1-6-15-27(16-7-2)31-32-33-19-25-14-13-21(23(25,3)4)18-26(25)29-22(28)24(5,30-26)17-20-11-9-8-10-12-20/h8-12,21H,6-7,13-19H2,1-5H3/t21?,24-,25?,26?/m1/s1 |
| InChIKey | QAWTWAPLZQRCGL-OCZHJASCSA-N |
| XLogP | 5.72 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|