C30H47NO6S — CID 11135404
tert-butyl (1'S,4S,4'R)-4-benzyl-1'-[di(propan-2-yl)sulfamoylmethyl]-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-carboxylate (PubChem CID 11135404) has the molecular formula C30H47NO6S and a molecular weight of 549.77 g/mol. Its IUPAC name is tert-butyl (1'S,4S,4'R)-4-benzyl-1'-[di(propan-2-yl)sulfamoylmethyl]-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-carboxylate.
| Compound Name | tert-butyl (1'S,4S,4'R)-4-benzyl-1'-[di(propan-2-yl)sulfamoylmethyl]-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-carboxylate |
|---|---|
| PubChem CID | 11135404 |
| Molecular Formula | C30H47NO6S |
| Molecular Weight | 549.77 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | tert-butyl (1'S,4S,4'R)-4-benzyl-1'-[di(propan-2-yl)sulfamoylmethyl]-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-4-carboxylate |
| SMILES | CC(C)N(C(C)C)S(=O)(=O)C[C@]12CC[C@H](CC13OC[C@@](Cc1ccccc1)(C(=O)OC(C)(C)C)O3)C2(C)C |
| InChI | InChI=1S/C30H47NO6S/c1-21(2)31(22(3)4)38(33,34)20-29-16-15-24(27(29,8)9)18-30(29)35-19-28(37-30,25(32)36-26(5,6)7)17-23-13-11-10-12-14-23/h10-14,21-22,24H,15-20H2,1-9H3/t24-,28+,29+,30?/m1/s1 |
| InChIKey | URRVFXALPAPKPF-KHYBTIFKSA-N |
| XLogP | 5.33 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.77 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |