C27H39NO5S — CID 11733680
1-[(1'S,2S,4S,4'R)-7',7'-dimethyl-5-oxo-4-phenyl-4-prop-2-enylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-di(propan-2-yl)methanesulfonamide (PubChem CID 11733680) has the molecular formula C27H39NO5S and a molecular weight of 489.68 g/mol. Its IUPAC name is 1-[(1'S,2S,4S,4'R)-7',7'-dimethyl-5-oxo-4-phenyl-4-prop-2-enylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-di(propan-2-yl)methanesulfonamide.
| Compound Name | 1-[(1'S,2S,4S,4'R)-7',7'-dimethyl-5-oxo-4-phenyl-4-prop-2-enylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-di(propan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 11733680 |
| Molecular Formula | C27H39NO5S |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 1-[(1'S,2S,4S,4'R)-7',7'-dimethyl-5-oxo-4-phenyl-4-prop-2-enylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-di(propan-2-yl)methanesulfonamide |
| SMILES | C=CC[C@@]1(c2ccccc2)O[C@@]2(C[C@H]3CC[C@]2(CS(=O)(=O)N(C(C)C)C(C)C)C3(C)C)OC1=O |
| InChI | InChI=1S/C27H39NO5S/c1-8-15-26(21-12-10-9-11-13-21)23(29)32-27(33-26)17-22-14-16-25(27,24(22,6)7)18-34(30,31)28(19(2)3)20(4)5/h8-13,19-20,22H,1,14-18H2,2-7H3/t22-,25+,26+,27-/m1/s1 |
| InChIKey | MNDUYQVECRKRSK-LHIMOPHOSA-N |
| XLogP | 5.00 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|