C9H5Cl2F3 — CID 101056231
1-(2,2-dichloro-3,3-difluorocyclopropyl)-4-fluorobenzene (PubChem CID 101056231) has the molecular formula C9H5Cl2F3 and a molecular weight of 241.04 g/mol. Its IUPAC name is 1-(2,2-dichloro-3,3-difluorocyclopropyl)-4-fluorobenzene.
| Compound Name | 1-(2,2-dichloro-3,3-difluorocyclopropyl)-4-fluorobenzene |
|---|---|
| PubChem CID | 101056231 |
| Molecular Formula | C9H5Cl2F3 |
| Molecular Weight | 241.04 g/mol |
| Exact Mass | 239.97 |
| IUPAC Name | 1-(2,2-dichloro-3,3-difluorocyclopropyl)-4-fluorobenzene |
| SMILES | Fc1ccc(C2C(F)(F)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C9H5Cl2F3/c10-8(11)7(9(8,13)14)5-1-3-6(12)4-2-5/h1-4,7H |
| InChIKey | YSSGRWALTNLWSJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.04 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|